About 2-cyanoprop-2-enyl 2-methylidenebutanoate
2-cyanoprop-2-enyl 2-methylidenebutanoate (PubChem CID 118216233) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 2-cyanoprop-2-enyl 2-methylidenebutanoate.
Molecular Properties
| Compound Name | 2-cyanoprop-2-enyl 2-methylidenebutanoate |
| PubChem CID | 118216233 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 2-cyanoprop-2-enyl 2-methylidenebutanoate |
| SMILES | C=C(C#N)COC(=O)C(=C)CC |
| InChI | InChI=1S/C9H11NO2/c1-4-8(3)9(11)12-6-7(2)5-10/h2-4,6H2,1H3 |
| InChIKey | VFNGYZFWFKVCLI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoprop-2-enyl 2-methylidenebutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoprop-2-enyl 2-methylidenebutanoate?
The IUPAC name of 2-cyanoprop-2-enyl 2-methylidenebutanoate (CID 118216233) is 2-cyanoprop-2-enyl 2-methylidenebutanoate.
What is the SMILES notation for 2-cyanoprop-2-enyl 2-methylidenebutanoate?
The canonical SMILES for 2-cyanoprop-2-enyl 2-methylidenebutanoate is C=C(C#N)COC(=O)C(=C)CC.
What is the InChIKey of 2-cyanoprop-2-enyl 2-methylidenebutanoate?
The InChIKey is VFNGYZFWFKVCLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-4-8(3)9(11)12-6-7(2)5-10/h2-4,6H2,1H3.
What are the key properties of 2-cyanoprop-2-enyl 2-methylidenebutanoate?
2-cyanoprop-2-enyl 2-methylidenebutanoate has a molecular weight of 165.19 g/mol, XLogP of 1.58, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoprop-2-enyl 2-methylidenebutanoate is sourced from PubChem (CID 118216233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).