C9H11F3O — CID 178140699
(3E)-3-methoxy-2-methyl-5-(trifluoromethyl)hexa-1,3,5-triene (PubChem CID 178140699) has the molecular formula C9H11F3O and a molecular weight of 192.18 g/mol. Its IUPAC name is (3E)-3-methoxy-2-methyl-5-(trifluoromethyl)hexa-1,3,5-triene.
| Compound Name | (3E)-3-methoxy-2-methyl-5-(trifluoromethyl)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 178140699 |
| Molecular Formula | C9H11F3O |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (3E)-3-methoxy-2-methyl-5-(trifluoromethyl)hexa-1,3,5-triene |
| SMILES | C=C(C)/C(=C\C(=C)C(F)(F)F)OC |
| InChI | InChI=1S/C9H11F3O/c1-6(2)8(13-4)5-7(3)9(10,11)12/h5H,1,3H2,2,4H3/b8-5+ |
| InChIKey | LXOZAWZWQMBDGO-VMPITWQZSA-N |
| XLogP | 3.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|