C11H11Cl3F3NO3 — CID 135215368
2,2,2-trichloroethyl N-[(3E)-2-methoxy-5-(trifluoromethyl)hexa-1,3,5-trien-3-yl]carbamate (PubChem CID 135215368) has the molecular formula C11H11Cl3F3NO3 and a molecular weight of 368.57 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(3E)-2-methoxy-5-(trifluoromethyl)hexa-1,3,5-trien-3-yl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(3E)-2-methoxy-5-(trifluoromethyl)hexa-1,3,5-trien-3-yl]carbamate |
|---|---|
| PubChem CID | 135215368 |
| Molecular Formula | C11H11Cl3F3NO3 |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 366.98 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(3E)-2-methoxy-5-(trifluoromethyl)hexa-1,3,5-trien-3-yl]carbamate |
| SMILES | C=C(OC)/C(=C\C(=C)C(F)(F)F)NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H11Cl3F3NO3/c1-6(11(15,16)17)4-8(7(2)20-3)18-9(19)21-5-10(12,13)14/h4H,1-2,5H2,3H3,(H,18,19)/b8-4+ |
| InChIKey | IRBFNHXCCAOAHP-XBXARRHUSA-N |
| XLogP | 4.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|