C10H17ClO — CID 144678723
(3E)-5-chloro-3-methoxy-2-methylhexa-1,3,5-triene;ethane (PubChem CID 144678723) has the molecular formula C10H17ClO and a molecular weight of 188.70 g/mol. Its IUPAC name is (3E)-5-chloro-3-methoxy-2-methylhexa-1,3,5-triene;ethane.
| Compound Name | (3E)-5-chloro-3-methoxy-2-methylhexa-1,3,5-triene;ethane |
|---|---|
| PubChem CID | 144678723 |
| Molecular Formula | C10H17ClO |
| Molecular Weight | 188.70 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | (3E)-5-chloro-3-methoxy-2-methylhexa-1,3,5-triene;ethane |
| SMILES | C=C(Cl)/C=C(/OC)C(=C)C.CC |
| InChI | InChI=1S/C8H11ClO.C2H6/c1-6(2)8(10-4)5-7(3)9;1-2/h5H,1,3H2,2,4H3;1-2H3/b8-5+; |
| InChIKey | RHDRXFBJBHKQED-HAAWTFQLSA-N |
| XLogP | 3.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.70 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|