C13H23ClO — CID 144677825
(3E)-5-chloro-2,2-dimethyl-3-prop-1-en-2-ylhexa-3,5-dien-1-ol;ethane (PubChem CID 144677825) has the molecular formula C13H23ClO and a molecular weight of 230.78 g/mol. Its IUPAC name is (3E)-5-chloro-2,2-dimethyl-3-prop-1-en-2-ylhexa-3,5-dien-1-ol;ethane.
| Compound Name | (3E)-5-chloro-2,2-dimethyl-3-prop-1-en-2-ylhexa-3,5-dien-1-ol;ethane |
|---|---|
| PubChem CID | 144677825 |
| Molecular Formula | C13H23ClO |
| Molecular Weight | 230.78 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | (3E)-5-chloro-2,2-dimethyl-3-prop-1-en-2-ylhexa-3,5-dien-1-ol;ethane |
| SMILES | C=C(Cl)/C=C(\C(=C)C)C(C)(C)CO.CC |
| InChI | InChI=1S/C11H17ClO.C2H6/c1-8(2)10(6-9(3)12)11(4,5)7-13;1-2/h6,13H,1,3,7H2,2,4-5H3;1-2H3/b10-6+; |
| InChIKey | VSJJNJIKBVTMIV-AAGWESIMSA-N |
| XLogP | 4.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.78 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|