C11H18O — CID 143577466
(3E)-3-ethenyl-2,2,5-trimethylhexa-3,5-dien-1-ol (PubChem CID 143577466) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (3E)-3-ethenyl-2,2,5-trimethylhexa-3,5-dien-1-ol.
| Compound Name | (3E)-3-ethenyl-2,2,5-trimethylhexa-3,5-dien-1-ol |
|---|---|
| PubChem CID | 143577466 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (3E)-3-ethenyl-2,2,5-trimethylhexa-3,5-dien-1-ol |
| SMILES | C=C/C(=C\C(=C)C)C(C)(C)CO |
| InChI | InChI=1S/C11H18O/c1-6-10(7-9(2)3)11(4,5)8-12/h6-7,12H,1-2,8H2,3-5H3/b10-7+ |
| InChIKey | HKKMXHDFEYVWFK-JXMROGBWSA-N |
| XLogP | 2.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|