C11H18S — CID 121222824
(3Z)-2,5,5-trimethyl-4-methylsulfanylhepta-1,3,6-triene (PubChem CID 121222824) has the molecular formula C11H18S and a molecular weight of 182.33 g/mol. Its IUPAC name is (3Z)-2,5,5-trimethyl-4-methylsulfanylhepta-1,3,6-triene.
| Compound Name | (3Z)-2,5,5-trimethyl-4-methylsulfanylhepta-1,3,6-triene |
|---|---|
| PubChem CID | 121222824 |
| Molecular Formula | C11H18S |
| Molecular Weight | 182.33 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (3Z)-2,5,5-trimethyl-4-methylsulfanylhepta-1,3,6-triene |
| SMILES | C=CC(C)(C)/C(=C/C(=C)C)SC |
| InChI | InChI=1S/C11H18S/c1-7-11(4,5)10(12-6)8-9(2)3/h7-8H,1-2H2,3-6H3/b10-8- |
| InChIKey | MSVXUMGPFHZABV-NTMALXAHSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|