C14H27N — CID 143577407
(3E)-3-ethenyl-2,2,5-trimethylhexa-3,5-dien-1-amine;propane (PubChem CID 143577407) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is (3E)-3-ethenyl-2,2,5-trimethylhexa-3,5-dien-1-amine;propane.
| Compound Name | (3E)-3-ethenyl-2,2,5-trimethylhexa-3,5-dien-1-amine;propane |
|---|---|
| PubChem CID | 143577407 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | (3E)-3-ethenyl-2,2,5-trimethylhexa-3,5-dien-1-amine;propane |
| SMILES | C=C/C(=C\C(=C)C)C(C)(C)CN.CCC |
| InChI | InChI=1S/C11H19N.C3H8/c1-6-10(7-9(2)3)11(4,5)8-12;1-3-2/h6-7H,1-2,8,12H2,3-5H3;3H2,1-2H3/b10-7+; |
| InChIKey | YHGQHEMGPFDYCC-HCUGZAAXSA-N |
| XLogP | 4.08 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|