C16H29NO — CID 143464209
ethane;(2E,4E)-5-(2-methyl-1-prop-2-enoxypropan-2-yl)hepta-2,4,6-trien-3-amine (PubChem CID 143464209) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is ethane;(2E,4E)-5-(2-methyl-1-prop-2-enoxypropan-2-yl)hepta-2,4,6-trien-3-amine.
| Compound Name | ethane;(2E,4E)-5-(2-methyl-1-prop-2-enoxypropan-2-yl)hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 143464209 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | ethane;(2E,4E)-5-(2-methyl-1-prop-2-enoxypropan-2-yl)hepta-2,4,6-trien-3-amine |
| SMILES | C=CCOCC(C)(C)/C(C=C)=C/C(N)=C\C.CC |
| InChI | InChI=1S/C14H23NO.C2H6/c1-6-9-16-11-14(4,5)12(7-2)10-13(15)8-3;1-2/h6-8,10H,1-2,9,11,15H2,3-5H3;1-2H3/b12-10+,13-8+; |
| InChIKey | QMVFMXFMJKBKMP-LCWAWBMPSA-N |
| XLogP | 4.22 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|