C11H17NO — CID 129076895
(2E,4E)-5-(prop-2-enoxymethyl)hepta-2,4,6-trien-3-amine (PubChem CID 129076895) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (2E,4E)-5-(prop-2-enoxymethyl)hepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4E)-5-(prop-2-enoxymethyl)hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 129076895 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (2E,4E)-5-(prop-2-enoxymethyl)hepta-2,4,6-trien-3-amine |
| SMILES | C=CCOC/C(C=C)=C/C(N)=C\C |
| InChI | InChI=1S/C11H17NO/c1-4-7-13-9-10(5-2)8-11(12)6-3/h4-6,8H,1-2,7,9,12H2,3H3/b10-8+,11-6+ |
| InChIKey | LTGXJUKWKQJCQK-UGHCYFJLSA-N |
| XLogP | 2.16 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|