C10H17BrO — CID 177023060
(3E)-3-(2-bromoethoxymethyl)penta-1,3-diene;ethene (PubChem CID 177023060) has the molecular formula C10H17BrO and a molecular weight of 233.15 g/mol. Its IUPAC name is (3E)-3-(2-bromoethoxymethyl)penta-1,3-diene;ethene.
| Compound Name | (3E)-3-(2-bromoethoxymethyl)penta-1,3-diene;ethene |
|---|---|
| PubChem CID | 177023060 |
| Molecular Formula | C10H17BrO |
| Molecular Weight | 233.15 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | (3E)-3-(2-bromoethoxymethyl)penta-1,3-diene;ethene |
| SMILES | C=C.C=C/C(=C\C)COCCBr |
| InChI | InChI=1S/C8H13BrO.C2H4/c1-3-8(4-2)7-10-6-5-9;1-2/h3-4H,1,5-7H2,2H3;1-2H2/b8-4+; |
| InChIKey | NRTIVMOBBIDTCC-ZFXMFRGYSA-N |
| XLogP | 3.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.15 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|