C18H33NO — CID 143577434
4-[(3E)-3-ethenyl-2,2,5-trimethylhexa-3,5-dienyl]morpholine;propane (PubChem CID 143577434) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is 4-[(3E)-3-ethenyl-2,2,5-trimethylhexa-3,5-dienyl]morpholine;propane.
| Compound Name | 4-[(3E)-3-ethenyl-2,2,5-trimethylhexa-3,5-dienyl]morpholine;propane |
|---|---|
| PubChem CID | 143577434 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | 4-[(3E)-3-ethenyl-2,2,5-trimethylhexa-3,5-dienyl]morpholine;propane |
| SMILES | C=C/C(=C\C(=C)C)C(C)(C)CN1CCOCC1.CCC |
| InChI | InChI=1S/C15H25NO.C3H8/c1-6-14(11-13(2)3)15(4,5)12-16-7-9-17-10-8-16;1-3-2/h6,11H,1-2,7-10,12H2,3-5H3;3H2,1-2H3/b14-11+; |
| InChIKey | IAUPEVQPFURGGY-JHGYPSGKSA-N |
| XLogP | 4.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|