C24H44N2O2 — CID 174958404
4-(2,2,11,11-tetramethyl-12-morpholin-4-yldodeca-3,9-dienyl)morpholine (PubChem CID 174958404) has the molecular formula C24H44N2O2 and a molecular weight of 392.63 g/mol. Its IUPAC name is 4-(2,2,11,11-tetramethyl-12-morpholin-4-yldodeca-3,9-dienyl)morpholine.
| Compound Name | 4-(2,2,11,11-tetramethyl-12-morpholin-4-yldodeca-3,9-dienyl)morpholine |
|---|---|
| PubChem CID | 174958404 |
| Molecular Formula | C24H44N2O2 |
| Molecular Weight | 392.63 g/mol |
| Exact Mass | 392.34 |
| IUPAC Name | 4-(2,2,11,11-tetramethyl-12-morpholin-4-yldodeca-3,9-dienyl)morpholine |
| SMILES | CC(C)(C=CCCCCC=CC(C)(C)CN1CCOCC1)CN1CCOCC1 |
| InChI | InChI=1S/C24H44N2O2/c1-23(2,21-25-13-17-27-18-14-25)11-9-7-5-6-8-10-12-24(3,4)22-26-15-19-28-20-16-26/h9-12H,5-8,13-22H2,1-4H3 |
| InChIKey | SOCPMJSQVRFZPR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.63 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|