About 1-(2,2-dimethylpropyl)-4-methylpiperazine;4-(2,2-dimethylpropyl)morpholine;methane
1-(2,2-dimethylpropyl)-4-methylpiperazine;4-(2,2-dimethylpropyl)morpholine;methane (PubChem CID 162058346) has the molecular formula C20H45N3O
and a molecular weight of 343.60 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-4-methylpiperazine;4-(2,2-dimethylpropyl)morpholine;methane.
Molecular Properties
| Compound Name | 1-(2,2-dimethylpropyl)-4-methylpiperazine;4-(2,2-dimethylpropyl)morpholine;methane |
| PubChem CID | 162058346 |
| Molecular Formula | C20H45N3O |
| Molecular Weight | 343.60 g/mol |
| Exact Mass | 343.36 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-4-methylpiperazine;4-(2,2-dimethylpropyl)morpholine;methane |
| SMILES | C.CC(C)(C)CN1CCOCC1.CN1CCN(CC(C)(C)C)CC1 |
| InChI | InChI=1S/C10H22N2.C9H19NO.CH4/c1-10(2,3)9-12-7-5-11(4)6-8-12;1-9(2,3)8-10-4-6-11-7-5-10;/h5-9H2,1-4H3;4-8H2,1-3H3;1H4 |
| InChIKey | YZMFVQCFEXVYAF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.60 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,2-dimethylpropyl)-4-methylpiperazine;4-(2,2-dimethylpropyl)morpholine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethylpropyl)-4-methylpiperazine;4-(2,2-dimethylpropyl)morpholine;methane?
The IUPAC name of 1-(2,2-dimethylpropyl)-4-methylpiperazine;4-(2,2-dimethylpropyl)morpholine;methane (CID 162058346) is 1-(2,2-dimethylpropyl)-4-methylpiperazine;4-(2,2-dimethylpropyl)morpholine;methane.
What is the SMILES notation for 1-(2,2-dimethylpropyl)-4-methylpiperazine;4-(2,2-dimethylpropyl)morpholine;methane?
The canonical SMILES for 1-(2,2-dimethylpropyl)-4-methylpiperazine;4-(2,2-dimethylpropyl)morpholine;methane is C.CC(C)(C)CN1CCOCC1.CN1CCN(CC(C)(C)C)CC1.
What is the InChIKey of 1-(2,2-dimethylpropyl)-4-methylpiperazine;4-(2,2-dimethylpropyl)morpholine;methane?
The InChIKey is YZMFVQCFEXVYAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2.C9H19NO.CH4/c1-10(2,3)9-12-7-5-11(4)6-8-12;1-9(2,3)8-10-4-6-11-7-5-10;/h5-9H2,1-4H3;4-8H2,1-3H3;1H4.
What are the key properties of 1-(2,2-dimethylpropyl)-4-methylpiperazine;4-(2,2-dimethylpropyl)morpholine;methane?
1-(2,2-dimethylpropyl)-4-methylpiperazine;4-(2,2-dimethylpropyl)morpholine;methane has a molecular weight of 343.60 g/mol, XLogP of 3.28, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethylpropyl)-4-methylpiperazine;4-(2,2-dimethylpropyl)morpholine;methane is sourced from PubChem (CID 162058346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).