C14H30N2 — CID 163906125
1-methyl-4-(2,2,4,4-tetramethylpentyl)piperazine (PubChem CID 163906125) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is 1-methyl-4-(2,2,4,4-tetramethylpentyl)piperazine.
| Compound Name | 1-methyl-4-(2,2,4,4-tetramethylpentyl)piperazine |
|---|---|
| PubChem CID | 163906125 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | 1-methyl-4-(2,2,4,4-tetramethylpentyl)piperazine |
| SMILES | CN1CCN(CC(C)(C)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H30N2/c1-13(2,3)11-14(4,5)12-16-9-7-15(6)8-10-16/h7-12H2,1-6H3 |
| InChIKey | KAGMOKSGAOWSTP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |