C18H38N2 — CID 162767005
1-(2,2,4,4,5-pentamethylhexyl)-4-propan-2-ylpiperazine (PubChem CID 162767005) has the molecular formula C18H38N2 and a molecular weight of 282.52 g/mol. Its IUPAC name is 1-(2,2,4,4,5-pentamethylhexyl)-4-propan-2-ylpiperazine.
| Compound Name | 1-(2,2,4,4,5-pentamethylhexyl)-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 162767005 |
| Molecular Formula | C18H38N2 |
| Molecular Weight | 282.52 g/mol |
| Exact Mass | 282.30 |
| IUPAC Name | 1-(2,2,4,4,5-pentamethylhexyl)-4-propan-2-ylpiperazine |
| SMILES | CC(C)N1CCN(CC(C)(C)CC(C)(C)C(C)C)CC1 |
| InChI | InChI=1S/C18H38N2/c1-15(2)18(7,8)13-17(5,6)14-19-9-11-20(12-10-19)16(3)4/h15-16H,9-14H2,1-8H3 |
| InChIKey | HIZNEGHVJCLQOW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |