C17H38N2 — CID 145194127
ethane;1-propan-2-yl-4-(2,2,4-trimethylpentyl)piperazine (PubChem CID 145194127) has the molecular formula C17H38N2 and a molecular weight of 270.50 g/mol. Its IUPAC name is ethane;1-propan-2-yl-4-(2,2,4-trimethylpentyl)piperazine.
| Compound Name | ethane;1-propan-2-yl-4-(2,2,4-trimethylpentyl)piperazine |
|---|---|
| PubChem CID | 145194127 |
| Molecular Formula | C17H38N2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | ethane;1-propan-2-yl-4-(2,2,4-trimethylpentyl)piperazine |
| SMILES | CC.CC(C)CC(C)(C)CN1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C15H32N2.C2H6/c1-13(2)11-15(5,6)12-16-7-9-17(10-8-16)14(3)4;1-2/h13-14H,7-12H2,1-6H3;1-2H3 |
| InChIKey | IAVSVEJVKGFJSE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |