C17H30N4 — CID 142390525
2-methyl-5-[4-(2,2,4-trimethylpentyl)piperazin-1-yl]pyrazine (PubChem CID 142390525) has the molecular formula C17H30N4 and a molecular weight of 290.46 g/mol. Its IUPAC name is 2-methyl-5-[4-(2,2,4-trimethylpentyl)piperazin-1-yl]pyrazine.
| Compound Name | 2-methyl-5-[4-(2,2,4-trimethylpentyl)piperazin-1-yl]pyrazine |
|---|---|
| PubChem CID | 142390525 |
| Molecular Formula | C17H30N4 |
| Molecular Weight | 290.46 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | 2-methyl-5-[4-(2,2,4-trimethylpentyl)piperazin-1-yl]pyrazine |
| SMILES | Cc1cnc(N2CCN(CC(C)(C)CC(C)C)CC2)cn1 |
| InChI | InChI=1S/C17H30N4/c1-14(2)10-17(4,5)13-20-6-8-21(9-7-20)16-12-18-15(3)11-19-16/h11-12,14H,6-10,13H2,1-5H3 |
| InChIKey | LCYQXDYHNRDFKE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |