C19H40BN2O — CID 170586545
CID 170586545 (PubChem CID 170586545) has the molecular formula C19H40BN2O and a molecular weight of 323.35 g/mol.
| Compound Name | CID 170586545 |
|---|---|
| PubChem CID | 170586545 |
| Molecular Formula | C19H40BN2O |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.32 |
| IUPAC Name | — |
| SMILES | CC.CC[B]CC(=O)N1CCN(CC(C)(C)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H34BN2O.C2H6/c1-7-18-12-15(21)20-10-8-19(9-11-20)14-17(5,6)13-16(2,3)4;1-2/h7-14H2,1-6H3;1-2H3 |
| InChIKey | QDBBFGWGRLUVIN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|