C11H21BrN2O — CID 65000467
1-[4-(3-bromo-2,2-dimethylpropyl)piperazin-1-yl]ethanone (PubChem CID 65000467) has the molecular formula C11H21BrN2O and a molecular weight of 277.21 g/mol. Its IUPAC name is 1-[4-(3-bromo-2,2-dimethylpropyl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(3-bromo-2,2-dimethylpropyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 65000467 |
| Molecular Formula | C11H21BrN2O |
| Molecular Weight | 277.21 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 1-[4-(3-bromo-2,2-dimethylpropyl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(CC(C)(C)CBr)CC1 |
| InChI | InChI=1S/C11H21BrN2O/c1-10(15)14-6-4-13(5-7-14)9-11(2,3)8-12/h4-9H2,1-3H3 |
| InChIKey | NDFRWGPOXDJMLY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|