C10H16BrF3N2O — CID 114327524
2-bromo-2-methyl-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propan-1-one (PubChem CID 114327524) has the molecular formula C10H16BrF3N2O and a molecular weight of 317.15 g/mol. Its IUPAC name is 2-bromo-2-methyl-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propan-1-one.
| Compound Name | 2-bromo-2-methyl-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 114327524 |
| Molecular Formula | C10H16BrF3N2O |
| Molecular Weight | 317.15 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 2-bromo-2-methyl-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propan-1-one |
| SMILES | CC(C)(Br)C(=O)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H16BrF3N2O/c1-9(2,11)8(17)16-5-3-15(4-6-16)7-10(12,13)14/h3-7H2,1-2H3 |
| InChIKey | MNTPBASZWKDTET-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.15 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|