C10H19F3N2O — CID 143483059
ethane;1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanone (PubChem CID 143483059) has the molecular formula C10H19F3N2O and a molecular weight of 240.27 g/mol. Its IUPAC name is ethane;1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanone.
| Compound Name | ethane;1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 143483059 |
| Molecular Formula | C10H19F3N2O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | ethane;1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanone |
| SMILES | CC.CC(=O)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C8H13F3N2O.C2H6/c1-7(14)13-4-2-12(3-5-13)6-8(9,10)11;1-2/h2-6H2,1H3;1-2H3 |
| InChIKey | OBYCGLSJQJKTGA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |