About 2-hydroxyethyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate
2-hydroxyethyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate (PubChem CID 79346575) has the molecular formula C9H15F3N2O3
and a molecular weight of 256.22 g/mol. Its IUPAC name is 2-hydroxyethyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate.
Analyze 2-hydroxyethyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate?
The IUPAC name of 2-hydroxyethyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate (CID 79346575) is 2-hydroxyethyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate.
What is the SMILES notation for 2-hydroxyethyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate?
The canonical SMILES for 2-hydroxyethyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate is O=C(OCCO)N1CCN(CC(F)(F)F)CC1.
What is the InChIKey of 2-hydroxyethyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate?
The InChIKey is DYHAXOIXLMDNGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N2O3/c10-9(11,12)7-13-1-3-14(4-2-13)8(16)17-6-5-15/h15H,1-7H2.
What are the key properties of 2-hydroxyethyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate?
2-hydroxyethyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate has a molecular weight of 256.22 g/mol, XLogP of 0.30, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate is sourced from PubChem (CID 79346575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).