C10H17F3N2O2 — CID 171145567
ethyl 4-(3,3,3-trifluoropropyl)piperazine-1-carboxylate (PubChem CID 171145567) has the molecular formula C10H17F3N2O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is ethyl 4-(3,3,3-trifluoropropyl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(3,3,3-trifluoropropyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171145567 |
| Molecular Formula | C10H17F3N2O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | ethyl 4-(3,3,3-trifluoropropyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CCC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H17F3N2O2/c1-2-17-9(16)15-7-5-14(6-8-15)4-3-10(11,12)13/h2-8H2,1H3 |
| InChIKey | GAPYBXFILGQJNV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |