C11H18F3NO2 — CID 59334005
ethyl 1-(3,3,3-trifluoropropyl)piperidine-4-carboxylate (PubChem CID 59334005) has the molecular formula C11H18F3NO2 and a molecular weight of 253.26 g/mol. Its IUPAC name is ethyl 1-(3,3,3-trifluoropropyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(3,3,3-trifluoropropyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 59334005 |
| Molecular Formula | C11H18F3NO2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | ethyl 1-(3,3,3-trifluoropropyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(CCC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H18F3NO2/c1-2-17-10(16)9-3-6-15(7-4-9)8-5-11(12,13)14/h9H,2-8H2,1H3 |
| InChIKey | QCSRZGLKMGGNTD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |