C12H20F3NO2 — CID 115518003
ethyl 1-(4,4,4-trifluorobutyl)piperidine-4-carboxylate (PubChem CID 115518003) has the molecular formula C12H20F3NO2 and a molecular weight of 267.29 g/mol. Its IUPAC name is ethyl 1-(4,4,4-trifluorobutyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(4,4,4-trifluorobutyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 115518003 |
| Molecular Formula | C12H20F3NO2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | ethyl 1-(4,4,4-trifluorobutyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(CCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H20F3NO2/c1-2-18-11(17)10-4-8-16(9-5-10)7-3-6-12(13,14)15/h10H,2-9H2,1H3 |
| InChIKey | PNNRMDKIQMUJBB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |