C9H13ClF3NO — CID 59333934
1-(3,3,3-trifluoropropyl)piperidine-4-carbonyl chloride (PubChem CID 59333934) has the molecular formula C9H13ClF3NO and a molecular weight of 243.66 g/mol. Its IUPAC name is 1-(3,3,3-trifluoropropyl)piperidine-4-carbonyl chloride.
| Compound Name | 1-(3,3,3-trifluoropropyl)piperidine-4-carbonyl chloride |
|---|---|
| PubChem CID | 59333934 |
| Molecular Formula | C9H13ClF3NO |
| Molecular Weight | 243.66 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 1-(3,3,3-trifluoropropyl)piperidine-4-carbonyl chloride |
| SMILES | O=C(Cl)C1CCN(CCC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H13ClF3NO/c10-8(15)7-1-4-14(5-2-7)6-3-9(11,12)13/h7H,1-6H2 |
| InChIKey | XHNZSBQBKZIXHF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.66 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|