C8H17Cl2F3N2 — CID 90482882
1-(3,3,3-trifluoropropyl)piperidin-4-amine;dihydrochloride (PubChem CID 90482882) has the molecular formula C8H17Cl2F3N2 and a molecular weight of 269.14 g/mol. Its IUPAC name is 1-(3,3,3-trifluoropropyl)piperidin-4-amine;dihydrochloride.
| Compound Name | 1-(3,3,3-trifluoropropyl)piperidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 90482882 |
| Molecular Formula | C8H17Cl2F3N2 |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 1-(3,3,3-trifluoropropyl)piperidin-4-amine;dihydrochloride |
| SMILES | Cl.Cl.NC1CCN(CCC(F)(F)F)CC1 |
| InChI | InChI=1S/C8H15F3N2.2ClH/c9-8(10,11)3-6-13-4-1-7(12)2-5-13;;/h7H,1-6,12H2;2*1H |
| InChIKey | RUVSZPUKYDLIFS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |