About 1-(4-acetylpiperazin-1-yl)-3-bromopropan-1-one;bromomethane
1-(4-acetylpiperazin-1-yl)-3-bromopropan-1-one;bromomethane (PubChem CID 143056300) has the molecular formula C10H18Br2N2O2
and a molecular weight of 358.07 g/mol. Its IUPAC name is 1-(4-acetylpiperazin-1-yl)-3-bromopropan-1-one;bromomethane.
Molecular Properties
| Compound Name | 1-(4-acetylpiperazin-1-yl)-3-bromopropan-1-one;bromomethane |
| PubChem CID | 143056300 |
| Molecular Formula | C10H18Br2N2O2 |
| Molecular Weight | 358.07 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 1-(4-acetylpiperazin-1-yl)-3-bromopropan-1-one;bromomethane |
| SMILES | CBr.CC(=O)N1CCN(C(=O)CCBr)CC1 |
| InChI | InChI=1S/C9H15BrN2O2.CH3Br/c1-8(13)11-4-6-12(7-5-11)9(14)2-3-10;1-2/h2-7H2,1H3;1H3 |
| InChIKey | RBYMAYMVOVSQSV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.07 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-acetylpiperazin-1-yl)-3-bromopropan-1-one;bromomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-acetylpiperazin-1-yl)-3-bromopropan-1-one;bromomethane?
The IUPAC name of 1-(4-acetylpiperazin-1-yl)-3-bromopropan-1-one;bromomethane (CID 143056300) is 1-(4-acetylpiperazin-1-yl)-3-bromopropan-1-one;bromomethane.
What is the SMILES notation for 1-(4-acetylpiperazin-1-yl)-3-bromopropan-1-one;bromomethane?
The canonical SMILES for 1-(4-acetylpiperazin-1-yl)-3-bromopropan-1-one;bromomethane is CBr.CC(=O)N1CCN(C(=O)CCBr)CC1.
What is the InChIKey of 1-(4-acetylpiperazin-1-yl)-3-bromopropan-1-one;bromomethane?
The InChIKey is RBYMAYMVOVSQSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15BrN2O2.CH3Br/c1-8(13)11-4-6-12(7-5-11)9(14)2-3-10;1-2/h2-7H2,1H3;1H3.
What are the key properties of 1-(4-acetylpiperazin-1-yl)-3-bromopropan-1-one;bromomethane?
1-(4-acetylpiperazin-1-yl)-3-bromopropan-1-one;bromomethane has a molecular weight of 358.07 g/mol, XLogP of 1.47, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-acetylpiperazin-1-yl)-3-bromopropan-1-one;bromomethane is sourced from PubChem (CID 143056300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).