C7H8BrF4NO — CID 130698703
3-bromo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)propan-1-one (PubChem CID 130698703) has the molecular formula C7H8BrF4NO and a molecular weight of 278.04 g/mol. Its IUPAC name is 3-bromo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)propan-1-one.
| Compound Name | 3-bromo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 130698703 |
| Molecular Formula | C7H8BrF4NO |
| Molecular Weight | 278.04 g/mol |
| Exact Mass | 276.97 |
| IUPAC Name | 3-bromo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)propan-1-one |
| SMILES | O=C(CCBr)N1CC(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C7H8BrF4NO/c8-2-1-5(14)13-3-6(9,10)7(11,12)4-13/h1-4H2 |
| InChIKey | KLSHXEFUDAZKGN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.04 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|