C9H16F2N2O — CID 91109495
6-amino-1-(3,3-difluoroazetidin-1-yl)hexan-1-one (PubChem CID 91109495) has the molecular formula C9H16F2N2O and a molecular weight of 206.24 g/mol. Its IUPAC name is 6-amino-1-(3,3-difluoroazetidin-1-yl)hexan-1-one.
| Compound Name | 6-amino-1-(3,3-difluoroazetidin-1-yl)hexan-1-one |
|---|---|
| PubChem CID | 91109495 |
| Molecular Formula | C9H16F2N2O |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 6-amino-1-(3,3-difluoroazetidin-1-yl)hexan-1-one |
| SMILES | NCCCCCC(=O)N1CC(F)(F)C1 |
| InChI | InChI=1S/C9H16F2N2O/c10-9(11)6-13(7-9)8(14)4-2-1-3-5-12/h1-7,12H2 |
| InChIKey | URWPPPVDUMMGRK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|