C9H11F4NO — CID 130624471
3-methyl-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)but-2-en-1-one (PubChem CID 130624471) has the molecular formula C9H11F4NO and a molecular weight of 225.18 g/mol. Its IUPAC name is 3-methyl-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)but-2-en-1-one.
| Compound Name | 3-methyl-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 130624471 |
| Molecular Formula | C9H11F4NO |
| Molecular Weight | 225.18 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 3-methyl-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)but-2-en-1-one |
| SMILES | CC(C)=CC(=O)N1CC(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C9H11F4NO/c1-6(2)3-7(15)14-4-8(10,11)9(12,13)5-14/h3H,4-5H2,1-2H3 |
| InChIKey | SUMZRCJAASCLIF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.18 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|