C21H39F6N5O2 — CID 174301969
7-methyl-4,10-bis(2,2,2-trifluoroethyl)-16,21-dioxa-1,4,7,10,13-pentazabicyclo[11.5.5]tricosane (PubChem CID 174301969) has the molecular formula C21H39F6N5O2 and a molecular weight of 507.56 g/mol. Its IUPAC name is 7-methyl-4,10-bis(2,2,2-trifluoroethyl)-16,21-dioxa-1,4,7,10,13-pentazabicyclo[11.5.5]tricosane.
| Compound Name | 7-methyl-4,10-bis(2,2,2-trifluoroethyl)-16,21-dioxa-1,4,7,10,13-pentazabicyclo[11.5.5]tricosane |
|---|---|
| PubChem CID | 174301969 |
| Molecular Formula | C21H39F6N5O2 |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | 7-methyl-4,10-bis(2,2,2-trifluoroethyl)-16,21-dioxa-1,4,7,10,13-pentazabicyclo[11.5.5]tricosane |
| SMILES | CN1CCN(CC(F)(F)F)CCN2CCOCCN(CCOCC2)CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C21H39F6N5O2/c1-28-2-4-31(18-20(22,23)24)8-6-29-10-14-33-16-12-30(13-17-34-15-11-29)7-9-32(5-3-28)19-21(25,26)27/h2-19H2,1H3 |
| InChIKey | OADMBDVHUKUTIG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 34.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|