C14H27N — CID 146324127
1-[(E)-2,2,5,5-tetramethylhex-3-enyl]pyrrolidine (PubChem CID 146324127) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is 1-[(E)-2,2,5,5-tetramethylhex-3-enyl]pyrrolidine.
| Compound Name | 1-[(E)-2,2,5,5-tetramethylhex-3-enyl]pyrrolidine |
|---|---|
| PubChem CID | 146324127 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | 1-[(E)-2,2,5,5-tetramethylhex-3-enyl]pyrrolidine |
| SMILES | CC(C)(C)/C=C/C(C)(C)CN1CCCC1 |
| InChI | InChI=1S/C14H27N/c1-13(2,3)8-9-14(4,5)12-15-10-6-7-11-15/h8-9H,6-7,10-12H2,1-5H3/b9-8+ |
| InChIKey | WWLIZZZAHYQFKS-CMDGGOBGSA-N |
| XLogP | 3.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|