C13H23NO — CID 130643090
3-(7-azaspiro[3.5]nonan-7-yl)-2,2-dimethylpropanal (PubChem CID 130643090) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 3-(7-azaspiro[3.5]nonan-7-yl)-2,2-dimethylpropanal.
| Compound Name | 3-(7-azaspiro[3.5]nonan-7-yl)-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 130643090 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 3-(7-azaspiro[3.5]nonan-7-yl)-2,2-dimethylpropanal |
| SMILES | CC(C)(C=O)CN1CCC2(CCC2)CC1 |
| InChI | InChI=1S/C13H23NO/c1-12(2,11-15)10-14-8-6-13(7-9-14)4-3-5-13/h11H,3-10H2,1-2H3 |
| InChIKey | XSFACXSBOYOTFI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|