C15H27NO — CID 66452950
4-(8-azaspiro[4.5]decan-8-yl)-3,3-dimethylbutan-2-one (PubChem CID 66452950) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is 4-(8-azaspiro[4.5]decan-8-yl)-3,3-dimethylbutan-2-one.
| Compound Name | 4-(8-azaspiro[4.5]decan-8-yl)-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 66452950 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 4-(8-azaspiro[4.5]decan-8-yl)-3,3-dimethylbutan-2-one |
| SMILES | CC(=O)C(C)(C)CN1CCC2(CCCC2)CC1 |
| InChI | InChI=1S/C15H27NO/c1-13(17)14(2,3)12-16-10-8-15(9-11-16)6-4-5-7-15/h4-12H2,1-3H3 |
| InChIKey | XCNNYVJBVJYVKL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |