C16H31NO — CID 166864833
4-[(E)-2-ethyl-2,6-dimethyloct-3-enyl]morpholine (PubChem CID 166864833) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is 4-[(E)-2-ethyl-2,6-dimethyloct-3-enyl]morpholine.
| Compound Name | 4-[(E)-2-ethyl-2,6-dimethyloct-3-enyl]morpholine |
|---|---|
| PubChem CID | 166864833 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | 4-[(E)-2-ethyl-2,6-dimethyloct-3-enyl]morpholine |
| SMILES | CCC(C)C/C=C/C(C)(CC)CN1CCOCC1 |
| InChI | InChI=1S/C16H31NO/c1-5-15(3)8-7-9-16(4,6-2)14-17-10-12-18-13-11-17/h7,9,15H,5-6,8,10-14H2,1-4H3/b9-7+ |
| InChIKey | UBOIAGUBIQNBFE-VQHVLOKHSA-N |
| XLogP | 3.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|