C14H28 — CID 174260323
3,3-dimethylbut-1-ene;bis(2-methylprop-1-ene) (PubChem CID 174260323) has the molecular formula C14H28 and a molecular weight of 196.38 g/mol. Its IUPAC name is 3,3-dimethylbut-1-ene;bis(2-methylprop-1-ene).
| Compound Name | 3,3-dimethylbut-1-ene;bis(2-methylprop-1-ene) |
|---|---|
| PubChem CID | 174260323 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | 3,3-dimethylbut-1-ene;bis(2-methylprop-1-ene) |
| SMILES | C=C(C)C.C=C(C)C.C=CC(C)(C)C |
| InChI | InChI=1S/C6H12.2C4H8/c1-5-6(2,3)4;2*1-4(2)3/h5H,1H2,2-4H3;2*1H2,2-3H3 |
| InChIKey | CVWBKZRJKBFEFQ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|