C9H14O2 — CID 143337042
(E,2E)-2-(2-methylprop-2-enylidene)pent-3-ene-1,4-diol (PubChem CID 143337042) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (E,2E)-2-(2-methylprop-2-enylidene)pent-3-ene-1,4-diol.
| Compound Name | (E,2E)-2-(2-methylprop-2-enylidene)pent-3-ene-1,4-diol |
|---|---|
| PubChem CID | 143337042 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (E,2E)-2-(2-methylprop-2-enylidene)pent-3-ene-1,4-diol |
| SMILES | C=C(C)/C=C(\C=C(/C)O)CO |
| InChI | InChI=1S/C9H14O2/c1-7(2)4-9(6-10)5-8(3)11/h4-5,10-11H,1,6H2,2-3H3/b8-5+,9-4+ |
| InChIKey | WZLGPZUIXRDPPK-CCMAPKILSA-N |
| XLogP | 1.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|