C15H28O — CID 143822245
ethane;(7Z)-7-ethenyl-9-methyldeca-7,9-dien-1-ol (PubChem CID 143822245) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is ethane;(7Z)-7-ethenyl-9-methyldeca-7,9-dien-1-ol.
| Compound Name | ethane;(7Z)-7-ethenyl-9-methyldeca-7,9-dien-1-ol |
|---|---|
| PubChem CID | 143822245 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | ethane;(7Z)-7-ethenyl-9-methyldeca-7,9-dien-1-ol |
| SMILES | C=C/C(=C\C(=C)C)CCCCCCO.CC |
| InChI | InChI=1S/C13H22O.C2H6/c1-4-13(11-12(2)3)9-7-5-6-8-10-14;1-2/h4,11,14H,1-2,5-10H2,3H3;1-2H3/b13-11+; |
| InChIKey | SIQIHPPMDHAVIT-BNSHTTSQSA-N |
| XLogP | 4.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|