C9H11ClO2 — CID 162681527
[(2E)-2-ethenyl-4-methylpenta-2,4-dienyl] carbonochloridate (PubChem CID 162681527) has the molecular formula C9H11ClO2 and a molecular weight of 186.64 g/mol. Its IUPAC name is [(2E)-2-ethenyl-4-methylpenta-2,4-dienyl] carbonochloridate.
| Compound Name | [(2E)-2-ethenyl-4-methylpenta-2,4-dienyl] carbonochloridate |
|---|---|
| PubChem CID | 162681527 |
| Molecular Formula | C9H11ClO2 |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | [(2E)-2-ethenyl-4-methylpenta-2,4-dienyl] carbonochloridate |
| SMILES | C=C/C(=C\C(=C)C)COC(=O)Cl |
| InChI | InChI=1S/C9H11ClO2/c1-4-8(5-7(2)3)6-12-9(10)11/h4-5H,1-2,6H2,3H3/b8-5+ |
| InChIKey | STIXPZCFKOKYOR-VMPITWQZSA-N |
| XLogP | 3.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|