C13H15ClN2O2S — CID 144532908
[(2E)-4-chloro-2-ethenylpenta-2,4-dienyl] N-(3,5-dimethyl-1,2-thiazol-4-yl)carbamate (PubChem CID 144532908) has the molecular formula C13H15ClN2O2S and a molecular weight of 298.80 g/mol. Its IUPAC name is [(2E)-4-chloro-2-ethenylpenta-2,4-dienyl] N-(3,5-dimethyl-1,2-thiazol-4-yl)carbamate.
| Compound Name | [(2E)-4-chloro-2-ethenylpenta-2,4-dienyl] N-(3,5-dimethyl-1,2-thiazol-4-yl)carbamate |
|---|---|
| PubChem CID | 144532908 |
| Molecular Formula | C13H15ClN2O2S |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | [(2E)-4-chloro-2-ethenylpenta-2,4-dienyl] N-(3,5-dimethyl-1,2-thiazol-4-yl)carbamate |
| SMILES | C=C/C(=C\C(=C)Cl)COC(=O)Nc1c(C)nsc1C |
| InChI | InChI=1S/C13H15ClN2O2S/c1-5-11(6-8(2)14)7-18-13(17)15-12-9(3)16-19-10(12)4/h5-6H,1-2,7H2,3-4H3,(H,15,17)/b11-6+ |
| InChIKey | CIUMOGJXAOZAAZ-IZZDOVSWSA-N |
| XLogP | 4.17 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|