C6H7NOS2 — CID 141055273
3,5-dimethyl-1,2-thiazole-4-carbothioic S-acid (PubChem CID 141055273) has the molecular formula C6H7NOS2 and a molecular weight of 173.26 g/mol. Its IUPAC name is 3,5-dimethyl-1,2-thiazole-4-carbothioic S-acid.
| Compound Name | 3,5-dimethyl-1,2-thiazole-4-carbothioic S-acid |
|---|---|
| PubChem CID | 141055273 |
| Molecular Formula | C6H7NOS2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.00 |
| IUPAC Name | 3,5-dimethyl-1,2-thiazole-4-carbothioic S-acid |
| SMILES | Cc1nsc(C)c1C(=O)S |
| InChI | InChI=1S/C6H7NOS2/c1-3-5(6(8)9)4(2)10-7-3/h1-2H3,(H,8,9) |
| InChIKey | IAYCSDDPPTZOJD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 29.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|