C6H4N2O2S — CID 82413415
5-cyano-3-methyl-1,2-thiazole-4-carboxylic acid (PubChem CID 82413415) has the molecular formula C6H4N2O2S and a molecular weight of 168.18 g/mol. Its IUPAC name is 5-cyano-3-methyl-1,2-thiazole-4-carboxylic acid.
| Compound Name | 5-cyano-3-methyl-1,2-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82413415 |
| Molecular Formula | C6H4N2O2S |
| Molecular Weight | 168.18 g/mol |
| Exact Mass | 168.00 |
| IUPAC Name | 5-cyano-3-methyl-1,2-thiazole-4-carboxylic acid |
| SMILES | Cc1nsc(C#N)c1C(=O)O |
| InChI | InChI=1S/C6H4N2O2S/c1-3-5(6(9)10)4(2-7)11-8-3/h1H3,(H,9,10) |
| InChIKey | JZRFEVYJJZPHIR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |