5-cyano-3-methyl-1,2-thiazole-4-carboxylic acid

C6H4N2O2S — CID 82413415

IUPAC5-cyano-3-methyl-1,2-thiazole-4-carboxylic acid
SMILESCc1nsc(C#N)c1C(=O)O
InChIInChI=1S/C6H4N2O2S/c1-3-5(6(9)10)4(2-7)11-8-3/h1H3,(H,9,10)
InChIKeyJZRFEVYJJZPHIR-UHFFFAOYSA-N
MW168.18 g/mol
LogP1.02
Rot. Bonds1

About 5-cyano-3-methyl-1,2-thiazole-4-carboxylic acid

5-cyano-3-methyl-1,2-thiazole-4-carboxylic acid (PubChem CID 82413415) has the molecular formula C6H4N2O2S and a molecular weight of 168.18 g/mol. Its IUPAC name is 5-cyano-3-methyl-1,2-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name5-cyano-3-methyl-1,2-thiazole-4-carboxylic acid
PubChem CID82413415
Molecular FormulaC6H4N2O2S
Molecular Weight168.18 g/mol
Exact Mass168.00
IUPAC Name5-cyano-3-methyl-1,2-thiazole-4-carboxylic acid
SMILESCc1nsc(C#N)c1C(=O)O
InChIInChI=1S/C6H4N2O2S/c1-3-5(6(9)10)4(2-7)11-8-3/h1H3,(H,9,10)
InChIKeyJZRFEVYJJZPHIR-UHFFFAOYSA-N
XLogP1.02
TPSA73.98 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.18
LogP ≤ 51.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-cyano-3-methyl-1,2-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-cyano-3-methyl-1,2-thiazole-4-carboxylic acid?
The IUPAC name of 5-cyano-3-methyl-1,2-thiazole-4-carboxylic acid (CID 82413415) is 5-cyano-3-methyl-1,2-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-cyano-3-methyl-1,2-thiazole-4-carboxylic acid?
The canonical SMILES for 5-cyano-3-methyl-1,2-thiazole-4-carboxylic acid is Cc1nsc(C#N)c1C(=O)O.
What is the InChIKey of 5-cyano-3-methyl-1,2-thiazole-4-carboxylic acid?
The InChIKey is JZRFEVYJJZPHIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O2S/c1-3-5(6(9)10)4(2-7)11-8-3/h1H3,(H,9,10).
What are the key properties of 5-cyano-3-methyl-1,2-thiazole-4-carboxylic acid?
5-cyano-3-methyl-1,2-thiazole-4-carboxylic acid has a molecular weight of 168.18 g/mol, XLogP of 1.02, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyano-3-methyl-1,2-thiazole-4-carboxylic acid is sourced from PubChem (CID 82413415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).