C14H14N2O3 — CID 144940827
[(2E)-2-ethenylpenta-2,4-dienyl] N-(6-formyl-3-pyridinyl)carbamate (PubChem CID 144940827) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is [(2E)-2-ethenylpenta-2,4-dienyl] N-(6-formyl-3-pyridinyl)carbamate.
| Compound Name | [(2E)-2-ethenylpenta-2,4-dienyl] N-(6-formyl-3-pyridinyl)carbamate |
|---|---|
| PubChem CID | 144940827 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | [(2E)-2-ethenylpenta-2,4-dienyl] N-(6-formyl-3-pyridinyl)carbamate |
| SMILES | C=C/C=C(\C=C)COC(=O)Nc1ccc(C=O)nc1 |
| InChI | InChI=1S/C14H14N2O3/c1-3-5-11(4-2)10-19-14(18)16-12-6-7-13(9-17)15-8-12/h3-9H,1-2,10H2,(H,16,18)/b11-5+ |
| InChIKey | COIDOBDZVKFSFC-VZUCSPMQSA-N |
| XLogP | 2.74 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|