C15H16O3 — CID 142940624
4-[(2E)-2-ethenylpenta-2,4-dienoxy]-3-methoxybenzaldehyde (PubChem CID 142940624) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 4-[(2E)-2-ethenylpenta-2,4-dienoxy]-3-methoxybenzaldehyde.
| Compound Name | 4-[(2E)-2-ethenylpenta-2,4-dienoxy]-3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 142940624 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 4-[(2E)-2-ethenylpenta-2,4-dienoxy]-3-methoxybenzaldehyde |
| SMILES | C=C/C=C(\C=C)COc1ccc(C=O)cc1OC |
| InChI | InChI=1S/C15H16O3/c1-4-6-12(5-2)11-18-14-8-7-13(10-16)9-15(14)17-3/h4-10H,1-2,11H2,3H3/b12-6+ |
| InChIKey | SKVBJHAHRUZYMV-WUXMJOGZSA-N |
| XLogP | 3.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|