C32H35FN2O4S — CID 169135303
[(2E)-2-ethenylpenta-2,4-dienyl] N-[3-[(Z)-1-(dimethylamino)-2-[4-fluoro-2-(2-methoxyethoxy)phenyl]-2-(3-methylthiophen-2-yl)ethenyl]phenyl]carbamate (PubChem CID 169135303) has the molecular formula C32H35FN2O4S and a molecular weight of 562.71 g/mol. Its IUPAC name is [(2E)-2-ethenylpenta-2,4-dienyl] N-[3-[(Z)-1-(dimethylamino)-2-[4-fluoro-2-(2-methoxyethoxy)phenyl]-2-(3-methylthiophen-2-yl)ethenyl]phenyl]carbamate.
| Compound Name | [(2E)-2-ethenylpenta-2,4-dienyl] N-[3-[(Z)-1-(dimethylamino)-2-[4-fluoro-2-(2-methoxyethoxy)phenyl]-2-(3-methylthiophen-2-yl)ethenyl]phenyl]carbamate |
|---|---|
| PubChem CID | 169135303 |
| Molecular Formula | C32H35FN2O4S |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | [(2E)-2-ethenylpenta-2,4-dienyl] N-[3-[(Z)-1-(dimethylamino)-2-[4-fluoro-2-(2-methoxyethoxy)phenyl]-2-(3-methylthiophen-2-yl)ethenyl]phenyl]carbamate |
| SMILES | C=C/C=C(\C=C)COC(=O)Nc1cccc(/C(=C(\c2ccc(F)cc2OCCOC)c2sccc2C)N(C)C)c1 |
| InChI | InChI=1S/C32H35FN2O4S/c1-7-10-23(8-2)21-39-32(36)34-26-12-9-11-24(19-26)30(35(4)5)29(31-22(3)15-18-40-31)27-14-13-25(33)20-28(27)38-17-16-37-6/h7-15,18-20H,1-2,16-17,21H2,3-6H3,(H,34,36)/b23-10+,30-29- |
| InChIKey | BITSXVFBWRGKPK-IFJFHPDNSA-N |
| XLogP | 7.55 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|