C15H19N3O4 — CID 144940825
[(E)-2-ethenylbut-2-enyl] N-[6-[methoxy(methyl)carbamoyl]-3-pyridinyl]carbamate (PubChem CID 144940825) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is [(E)-2-ethenylbut-2-enyl] N-[6-[methoxy(methyl)carbamoyl]-3-pyridinyl]carbamate.
| Compound Name | [(E)-2-ethenylbut-2-enyl] N-[6-[methoxy(methyl)carbamoyl]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 144940825 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | [(E)-2-ethenylbut-2-enyl] N-[6-[methoxy(methyl)carbamoyl]-3-pyridinyl]carbamate |
| SMILES | C=C/C(=C\C)COC(=O)Nc1ccc(C(=O)N(C)OC)nc1 |
| InChI | InChI=1S/C15H19N3O4/c1-5-11(6-2)10-22-15(20)17-12-7-8-13(16-9-12)14(19)18(3)21-4/h5-9H,1,10H2,2-4H3,(H,17,20)/b11-6+ |
| InChIKey | NACFBXGHXAKJSY-IZZDOVSWSA-N |
| XLogP | 2.40 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|