About ethane;[(3Z)-3-ethenyl-5-methylhexa-3,5-dienoxy]cyclopropane
ethane;[(3Z)-3-ethenyl-5-methylhexa-3,5-dienoxy]cyclopropane (PubChem CID 155687678) has the molecular formula C14H24O
and a molecular weight of 208.34 g/mol. Its IUPAC name is ethane;[(3Z)-3-ethenyl-5-methylhexa-3,5-dienoxy]cyclopropane.
Molecular Properties
| Compound Name | ethane;[(3Z)-3-ethenyl-5-methylhexa-3,5-dienoxy]cyclopropane |
| PubChem CID | 155687678 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | ethane;[(3Z)-3-ethenyl-5-methylhexa-3,5-dienoxy]cyclopropane |
| SMILES | C=C/C(=C\C(=C)C)CCOC1CC1.CC |
| InChI | InChI=1S/C12H18O.C2H6/c1-4-11(9-10(2)3)7-8-13-12-5-6-12;1-2/h4,9,12H,1-2,5-8H2,3H3;1-2H3/b11-9+; |
| InChIKey | XMGBXGFIUCISAA-LBEJWNQZSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;[(3Z)-3-ethenyl-5-methylhexa-3,5-dienoxy]cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[(3Z)-3-ethenyl-5-methylhexa-3,5-dienoxy]cyclopropane?
The IUPAC name of ethane;[(3Z)-3-ethenyl-5-methylhexa-3,5-dienoxy]cyclopropane (CID 155687678) is ethane;[(3Z)-3-ethenyl-5-methylhexa-3,5-dienoxy]cyclopropane.
What is the SMILES notation for ethane;[(3Z)-3-ethenyl-5-methylhexa-3,5-dienoxy]cyclopropane?
The canonical SMILES for ethane;[(3Z)-3-ethenyl-5-methylhexa-3,5-dienoxy]cyclopropane is C=C/C(=C\C(=C)C)CCOC1CC1.CC.
What is the InChIKey of ethane;[(3Z)-3-ethenyl-5-methylhexa-3,5-dienoxy]cyclopropane?
The InChIKey is XMGBXGFIUCISAA-LBEJWNQZSA-N. The full InChI is InChI=1S/C12H18O.C2H6/c1-4-11(9-10(2)3)7-8-13-12-5-6-12;1-2/h4,9,12H,1-2,5-8H2,3H3;1-2H3/b11-9+;.
What are the key properties of ethane;[(3Z)-3-ethenyl-5-methylhexa-3,5-dienoxy]cyclopropane?
ethane;[(3Z)-3-ethenyl-5-methylhexa-3,5-dienoxy]cyclopropane has a molecular weight of 208.34 g/mol, XLogP of 4.27, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[(3Z)-3-ethenyl-5-methylhexa-3,5-dienoxy]cyclopropane is sourced from PubChem (CID 155687678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).