C16H24ClNO — CID 138741832
1-[(4Z,6Z)-6-chloro-7-cyclopropyloxy-4-ethenylocta-4,6-dienyl]azetidine (PubChem CID 138741832) has the molecular formula C16H24ClNO and a molecular weight of 281.83 g/mol. Its IUPAC name is 1-[(4Z,6Z)-6-chloro-7-cyclopropyloxy-4-ethenylocta-4,6-dienyl]azetidine.
| Compound Name | 1-[(4Z,6Z)-6-chloro-7-cyclopropyloxy-4-ethenylocta-4,6-dienyl]azetidine |
|---|---|
| PubChem CID | 138741832 |
| Molecular Formula | C16H24ClNO |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 1-[(4Z,6Z)-6-chloro-7-cyclopropyloxy-4-ethenylocta-4,6-dienyl]azetidine |
| SMILES | C=C/C(=C\C(Cl)=C(/C)OC1CC1)CCCN1CCC1 |
| InChI | InChI=1S/C16H24ClNO/c1-3-14(6-4-9-18-10-5-11-18)12-16(17)13(2)19-15-7-8-15/h3,12,15H,1,4-11H2,2H3/b14-12+,16-13- |
| InChIKey | QQZVDTHCWFCVSL-QLKCLSONSA-N |
| XLogP | 4.23 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|